C28H25OS+ — CID 142344509
(9aS)-10'-hydroxy-2',3',7'-trimethylspiro[4a,9a-dihydrofluorene-9,9'-thioxanthen-10-ium] (PubChem CID 142344509) has the molecular formula C28H25OS+ and a molecular weight of 409.57 g/mol. Its IUPAC name is (9aS)-10'-hydroxy-2',3',7'-trimethylspiro[4a,9a-dihydrofluorene-9,9'-thioxanthen-10-ium].
| Compound Name | (9aS)-10'-hydroxy-2',3',7'-trimethylspiro[4a,9a-dihydrofluorene-9,9'-thioxanthen-10-ium] |
|---|---|
| PubChem CID | 142344509 |
| Molecular Formula | C28H25OS+ |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (9aS)-10'-hydroxy-2',3',7'-trimethylspiro[4a,9a-dihydrofluorene-9,9'-thioxanthen-10-ium] |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3C3C=CC=C[C@@H]31)c1cc(C)c(C)cc1[S+]2O |
| InChI | InChI=1S/C28H25OS/c1-17-12-13-26-24(14-17)28(25-15-18(2)19(3)16-27(25)30(26)29)22-10-6-4-8-20(22)21-9-5-7-11-23(21)28/h4-16,20,22,29H,1-3H3/q+1/t20?,22-,28?,30?/m0/s1 |
| InChIKey | URZHATTWKXTJRZ-BCPVXUNUSA-N |
| XLogP | 6.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|