C18H20 — CID 145280766
spiro[4a,9a-dihydrofluorene-9,1'-cyclohexane] (PubChem CID 145280766) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is spiro[4a,9a-dihydrofluorene-9,1'-cyclohexane].
| Compound Name | spiro[4a,9a-dihydrofluorene-9,1'-cyclohexane] |
|---|---|
| PubChem CID | 145280766 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | spiro[4a,9a-dihydrofluorene-9,1'-cyclohexane] |
| SMILES | C1=CC2c3ccccc3C3(CCCCC3)C2C=C1 |
| InChI | InChI=1S/C18H20/c1-6-12-18(13-7-1)16-10-4-2-8-14(16)15-9-3-5-11-17(15)18/h2-5,8-11,14,16H,1,6-7,12-13H2 |
| InChIKey | RDFSGKZPFWBDKU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |