C25H27N5O5 — CID 142348418
3-[4-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethoxy]-2-methanimidoylanilino]-3-(6-methoxy-3-pyridinyl)propanoic acid (PubChem CID 142348418) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 3-[4-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethoxy]-2-methanimidoylanilino]-3-(6-methoxy-3-pyridinyl)propanoic acid.
| Compound Name | 3-[4-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethoxy]-2-methanimidoylanilino]-3-(6-methoxy-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 142348418 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-[4-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethoxy]-2-methanimidoylanilino]-3-(6-methoxy-3-pyridinyl)propanoic acid |
| SMILES | [H]/N=C/c1cc(OCCc2ccc3c(n2)NCCO3)ccc1NC(CC(=O)O)c1ccc(OC)nc1 |
| InChI | InChI=1S/C25H27N5O5/c1-33-23-7-2-16(15-28-23)21(13-24(31)32)30-20-5-4-19(12-17(20)14-26)34-10-8-18-3-6-22-25(29-18)27-9-11-35-22/h2-7,12,14-15,21,26,30H,8-11,13H2,1H3,(H,27,29)(H,31,32)/b26-14+ |
| InChIKey | ZFGGSXXLMXVKAV-VULFUBBASA-N |
| XLogP | 3.54 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|