C21H28FN3O3S — CID 142350484
ethyl (E)-2-ethyl-4-[3-fluoro-2-[(E)-3-oxoprop-1-enyl]azetidin-1-yl]-3-[[(E)-1-(1,3-thiazol-2-yl)but-1-enyl]amino]but-2-enoate (PubChem CID 142350484) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl (E)-2-ethyl-4-[3-fluoro-2-[(E)-3-oxoprop-1-enyl]azetidin-1-yl]-3-[[(E)-1-(1,3-thiazol-2-yl)but-1-enyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-2-ethyl-4-[3-fluoro-2-[(E)-3-oxoprop-1-enyl]azetidin-1-yl]-3-[[(E)-1-(1,3-thiazol-2-yl)but-1-enyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 142350484 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | ethyl (E)-2-ethyl-4-[3-fluoro-2-[(E)-3-oxoprop-1-enyl]azetidin-1-yl]-3-[[(E)-1-(1,3-thiazol-2-yl)but-1-enyl]amino]but-2-enoate |
| SMILES | CC/C=C(/N/C(CN1CC(F)C1/C=C/C=O)=C(\CC)C(=O)OCC)c1nccs1 |
| InChI | InChI=1S/C21H28FN3O3S/c1-4-8-17(20-23-10-12-29-20)24-18(15(5-2)21(27)28-6-3)14-25-13-16(22)19(25)9-7-11-26/h7-12,16,19,24H,4-6,13-14H2,1-3H3/b9-7+,17-8+,18-15+ |
| InChIKey | VFJHMNFDSPQSOL-LMZHXLMXSA-N |
| XLogP | 3.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|