C12H18N2O2S — CID 103253569
methyl (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)ethylamino]but-2-enoate (PubChem CID 103253569) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is methyl (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)ethylamino]but-2-enoate.
| Compound Name | methyl (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 103253569 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)ethylamino]but-2-enoate |
| SMILES | CC/C(=C/CNC(C)c1nccs1)C(=O)OC |
| InChI | InChI=1S/C12H18N2O2S/c1-4-10(12(15)16-3)5-6-13-9(2)11-14-7-8-17-11/h5,7-9,13H,4,6H2,1-3H3/b10-5- |
| InChIKey | FWMYBKJANXWRSM-YHYXMXQVSA-N |
| XLogP | 2.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|