About [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane
[4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane (PubChem CID 142350691) has the molecular formula C16H30F2INOS
and a molecular weight of 449.39 g/mol. Its IUPAC name is [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane.
Molecular Properties
| Compound Name | [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane |
| PubChem CID | 142350691 |
| Molecular Formula | C16H30F2INOS |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane |
| SMILES | C/C=C\C(=C/CC)CN1CC(OSI)C(F)(F)C1.CC.CC |
| InChI | InChI=1S/C12H18F2INOS.2C2H6/c1-3-5-10(6-4-2)7-16-8-11(17-18-15)12(13,14)9-16;2*1-2/h3,5-6,11H,4,7-9H2,1-2H3;2*1-2H3/b5-3-,10-6+;; |
| InChIKey | REIJKFDPJKRDII-PKCFVQNSSA-N |
| XLogP | 6.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane?
The IUPAC name of [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane (CID 142350691) is [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane.
What is the SMILES notation for [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane?
The canonical SMILES for [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane is C/C=C\C(=C/CC)CN1CC(OSI)C(F)(F)C1.CC.CC.
What is the InChIKey of [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane?
The InChIKey is REIJKFDPJKRDII-PKCFVQNSSA-N. The full InChI is InChI=1S/C12H18F2INOS.2C2H6/c1-3-5-10(6-4-2)7-16-8-11(17-18-15)12(13,14)9-16;2*1-2/h3,5-6,11H,4,7-9H2,1-2H3;2*1-2H3/b5-3-,10-6+;;.
What are the key properties of [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane?
[4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane has a molecular weight of 449.39 g/mol, XLogP of 6.29, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-difluoro-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]pyrrolidin-3-yl]oxy thiohypoiodite;ethane is sourced from PubChem (CID 142350691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).