C9H16FNO2S — CID 142350823
2-[(5-fluoro-1-methylpiperidin-2-yl)methylsulfanyl]acetic acid (PubChem CID 142350823) has the molecular formula C9H16FNO2S and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(5-fluoro-1-methylpiperidin-2-yl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(5-fluoro-1-methylpiperidin-2-yl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 142350823 |
| Molecular Formula | C9H16FNO2S |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-[(5-fluoro-1-methylpiperidin-2-yl)methylsulfanyl]acetic acid |
| SMILES | CN1CC(F)CCC1CSCC(=O)O |
| InChI | InChI=1S/C9H16FNO2S/c1-11-4-7(10)2-3-8(11)5-14-6-9(12)13/h7-8H,2-6H2,1H3,(H,12,13) |
| InChIKey | MUUUFTMFQFFHEP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |