C10H18FNO2S — CID 153412182
2-[(4-fluoro-1-propan-2-ylpyrrolidin-2-yl)methylsulfanyl]acetic acid (PubChem CID 153412182) has the molecular formula C10H18FNO2S and a molecular weight of 235.32 g/mol. Its IUPAC name is 2-[(4-fluoro-1-propan-2-ylpyrrolidin-2-yl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(4-fluoro-1-propan-2-ylpyrrolidin-2-yl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 153412182 |
| Molecular Formula | C10H18FNO2S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[(4-fluoro-1-propan-2-ylpyrrolidin-2-yl)methylsulfanyl]acetic acid |
| SMILES | CC(C)N1CC(F)CC1CSCC(=O)O |
| InChI | InChI=1S/C10H18FNO2S/c1-7(2)12-4-8(11)3-9(12)5-15-6-10(13)14/h7-9H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | VBTWRNQJDVUNIT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |