C11H20FNO2S — CID 153412194
2-[(1-tert-butyl-4-fluoropyrrolidin-3-yl)methylsulfanyl]acetic acid (PubChem CID 153412194) has the molecular formula C11H20FNO2S and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[(1-tert-butyl-4-fluoropyrrolidin-3-yl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(1-tert-butyl-4-fluoropyrrolidin-3-yl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 153412194 |
| Molecular Formula | C11H20FNO2S |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-[(1-tert-butyl-4-fluoropyrrolidin-3-yl)methylsulfanyl]acetic acid |
| SMILES | CC(C)(C)N1CC(F)C(CSCC(=O)O)C1 |
| InChI | InChI=1S/C11H20FNO2S/c1-11(2,3)13-4-8(9(12)5-13)6-16-7-10(14)15/h8-9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | VBAXOLQKPZPOFH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |