C11H12ClNO3 — CID 142352390
(4R)-4-(4-chlorophenyl)pyrrolidin-2-one;formic acid (PubChem CID 142352390) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is (4R)-4-(4-chlorophenyl)pyrrolidin-2-one;formic acid.
| Compound Name | (4R)-4-(4-chlorophenyl)pyrrolidin-2-one;formic acid |
|---|---|
| PubChem CID | 142352390 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (4R)-4-(4-chlorophenyl)pyrrolidin-2-one;formic acid |
| SMILES | O=C1C[C@H](c2ccc(Cl)cc2)CN1.O=CO |
| InChI | InChI=1S/C10H10ClNO.CH2O2/c11-9-3-1-7(2-4-9)8-5-10(13)12-6-8;2-1-3/h1-4,8H,5-6H2,(H,12,13);1H,(H,2,3)/t8-;/m0./s1 |
| InChIKey | ZKGYAUBOXNGPDY-QRPNPIFTSA-N |
| XLogP | 1.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|