C11H12ClF2NS — CID 142352413
3-(4-chloro-2,6-difluorophenyl)-4-(methylamino)butanethial (PubChem CID 142352413) has the molecular formula C11H12ClF2NS and a molecular weight of 263.74 g/mol. Its IUPAC name is 3-(4-chloro-2,6-difluorophenyl)-4-(methylamino)butanethial.
| Compound Name | 3-(4-chloro-2,6-difluorophenyl)-4-(methylamino)butanethial |
|---|---|
| PubChem CID | 142352413 |
| Molecular Formula | C11H12ClF2NS |
| Molecular Weight | 263.74 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 3-(4-chloro-2,6-difluorophenyl)-4-(methylamino)butanethial |
| SMILES | CNCC(CC=S)c1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C11H12ClF2NS/c1-15-6-7(2-3-16)11-9(13)4-8(12)5-10(11)14/h3-5,7,15H,2,6H2,1H3 |
| InChIKey | LVDQYCQUDXQFLM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|