C51H43NO6 — CID 142352930
6-[4-[4-[8-(aminomethyl)dibenzofuran-1-yl]phenyl]phenyl]benzene-1,2,3,4,5-pentol;1-cyclohexa-1,3-dien-1-yl-3-(1-phenylethyl)benzene (PubChem CID 142352930) has the molecular formula C51H43NO6 and a molecular weight of 765.91 g/mol. Its IUPAC name is 6-[4-[4-[8-(aminomethyl)dibenzofuran-1-yl]phenyl]phenyl]benzene-1,2,3,4,5-pentol;1-cyclohexa-1,3-dien-1-yl-3-(1-phenylethyl)benzene.
| Compound Name | 6-[4-[4-[8-(aminomethyl)dibenzofuran-1-yl]phenyl]phenyl]benzene-1,2,3,4,5-pentol;1-cyclohexa-1,3-dien-1-yl-3-(1-phenylethyl)benzene |
|---|---|
| PubChem CID | 142352930 |
| Molecular Formula | C51H43NO6 |
| Molecular Weight | 765.91 g/mol |
| Exact Mass | 765.31 |
| IUPAC Name | 6-[4-[4-[8-(aminomethyl)dibenzofuran-1-yl]phenyl]phenyl]benzene-1,2,3,4,5-pentol;1-cyclohexa-1,3-dien-1-yl-3-(1-phenylethyl)benzene |
| SMILES | CC(c1ccccc1)c1cccc(C2=CC=CCC2)c1.NCc1ccc2oc3cccc(-c4ccc(-c5ccc(-c6c(O)c(O)c(O)c(O)c6O)cc5)cc4)c3c2c1 |
| InChI | InChI=1S/C31H23NO6.C20H20/c32-15-16-4-13-23-22(14-16)26-21(2-1-3-24(26)38-23)19-9-5-17(6-10-19)18-7-11-20(12-8-18)25-27(33)29(35)31(37)30(36)28(25)34;1-16(17-9-4-2-5-10-17)19-13-8-14-20(15-19)18-11-6-3-7-12-18/h1-14,33-37H,15,32H2;2-6,8-11,13-16H,7,12H2,1H3 |
| InChIKey | JADPONHVSSGRFR-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.91 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|