C42H32N4S — CID 142353396
5-[4-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]cyclohexa-1,3-dien-1-yl]quinoline (PubChem CID 142353396) has the molecular formula C42H32N4S and a molecular weight of 624.81 g/mol. Its IUPAC name is 5-[4-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]cyclohexa-1,3-dien-1-yl]quinoline.
| Compound Name | 5-[4-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]cyclohexa-1,3-dien-1-yl]quinoline |
|---|---|
| PubChem CID | 142353396 |
| Molecular Formula | C42H32N4S |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 5-[4-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]cyclohexa-1,3-dien-1-yl]quinoline |
| SMILES | C1=CCC(c2nc(C3=c4c(sc5c(C6=CC=C(c7cccc8ncccc78)CC6)cccc45)=CCC3)nc(-c3ccccc3)n2)C=C1 |
| InChI | InChI=1S/C42H32N4S/c1-3-11-29(12-4-1)40-44-41(30-13-5-2-6-14-30)46-42(45-40)35-18-9-21-37-38(35)34-17-7-16-32(39(34)47-37)28-24-22-27(23-25-28)31-15-8-20-36-33(31)19-10-26-43-36/h1-8,10-13,15-17,19-22,24,26,30H,9,14,18,23,25H2 |
| InChIKey | HSIQKDLXXSMNSQ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |