C6H6N2OS — CID 142354125
(5-methyl-1,3-oxazol-2-yl)methyl thiocyanate (PubChem CID 142354125) has the molecular formula C6H6N2OS and a molecular weight of 154.19 g/mol. Its IUPAC name is (5-methyl-1,3-oxazol-2-yl)methyl thiocyanate.
| Compound Name | (5-methyl-1,3-oxazol-2-yl)methyl thiocyanate |
|---|---|
| PubChem CID | 142354125 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | (5-methyl-1,3-oxazol-2-yl)methyl thiocyanate |
| SMILES | Cc1cnc(CSC#N)o1 |
| InChI | InChI=1S/C6H6N2OS/c1-5-2-8-6(9-5)3-10-4-7/h2H,3H2,1H3 |
| InChIKey | AEBOOSBPMPRMEJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|