C31H37NO2 — CID 142354573
(5S)-N-tert-butyl-6-phenylmethoxy-5-[(4-phenylphenyl)methyl]hept-6-enamide (PubChem CID 142354573) has the molecular formula C31H37NO2 and a molecular weight of 455.64 g/mol. Its IUPAC name is (5S)-N-tert-butyl-6-phenylmethoxy-5-[(4-phenylphenyl)methyl]hept-6-enamide.
| Compound Name | (5S)-N-tert-butyl-6-phenylmethoxy-5-[(4-phenylphenyl)methyl]hept-6-enamide |
|---|---|
| PubChem CID | 142354573 |
| Molecular Formula | C31H37NO2 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (5S)-N-tert-butyl-6-phenylmethoxy-5-[(4-phenylphenyl)methyl]hept-6-enamide |
| SMILES | C=C(OCc1ccccc1)[C@@H](CCCC(=O)NC(C)(C)C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H37NO2/c1-24(34-23-26-12-7-5-8-13-26)29(16-11-17-30(33)32-31(2,3)4)22-25-18-20-28(21-19-25)27-14-9-6-10-15-27/h5-10,12-15,18-21,29H,1,11,16-17,22-23H2,2-4H3,(H,32,33)/t29-/m0/s1 |
| InChIKey | RTCIHDLIXHGCNL-LJAQVGFWSA-N |
| XLogP | 7.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|