About 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde
2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde (PubChem CID 142358939) has the molecular formula C13H29N2O3+
and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde |
| PubChem CID | 142358939 |
| Molecular Formula | C13H29N2O3+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde |
| SMILES | CC(=O)C[NH3+].COC(C)(C)C.O=CN1CCCC1 |
| InChI | InChI=1S/C5H9NO.C5H12O.C3H7NO/c7-5-6-3-1-2-4-6;1-5(2,3)6-4;1-3(5)2-4/h5H,1-4H2;1-4H3;2,4H2,1H3/p+1 |
| InChIKey | HYMQDHJDOUDUDO-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde?
The IUPAC name of 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde (CID 142358939) is 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde.
What is the SMILES notation for 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde?
The canonical SMILES for 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde is CC(=O)C[NH3+].COC(C)(C)C.O=CN1CCCC1.
What is the InChIKey of 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde?
The InChIKey is HYMQDHJDOUDUDO-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H9NO.C5H12O.C3H7NO/c7-5-6-3-1-2-4-6;1-5(2,3)6-4;1-3(5)2-4/h5H,1-4H2;1-4H3;2,4H2,1H3/p+1.
What are the key properties of 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde?
2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde has a molecular weight of 261.39 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-methylpropane;2-oxopropylazanium;pyrrolidine-1-carbaldehyde is sourced from PubChem (CID 142358939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).