C25H25IN4O3S2 — CID 142359174
2-[[4-(2-formyl-6-methoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-[2-(4-methylphenyl)ethylsulfanyl]amino]ethyl thiohypoiodite (PubChem CID 142359174) has the molecular formula C25H25IN4O3S2 and a molecular weight of 620.54 g/mol. Its IUPAC name is 2-[[4-(2-formyl-6-methoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-[2-(4-methylphenyl)ethylsulfanyl]amino]ethyl thiohypoiodite.
| Compound Name | 2-[[4-(2-formyl-6-methoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-[2-(4-methylphenyl)ethylsulfanyl]amino]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 142359174 |
| Molecular Formula | C25H25IN4O3S2 |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 620.04 |
| IUPAC Name | 2-[[4-(2-formyl-6-methoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-[2-(4-methylphenyl)ethylsulfanyl]amino]ethyl thiohypoiodite |
| SMILES | COc1cccc(C=O)c1-n1c(-c2ccco2)nnc1N(CCSI)SCCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H25IN4O3S2/c1-18-8-10-19(11-9-18)12-15-35-29(13-16-34-26)25-28-27-24(22-7-4-14-33-22)30(25)23-20(17-31)5-3-6-21(23)32-2/h3-11,14,17H,12-13,15-16H2,1-2H3 |
| InChIKey | OPSOZMGZKQYVMQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|