C25H39N4O8PSSi — CID 153430020
1-diethoxyphosphoryl-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-N-(2-trimethylsilylethyl)ethanesulfonamide (PubChem CID 153430020) has the molecular formula C25H39N4O8PSSi and a molecular weight of 614.73 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-N-(2-trimethylsilylethyl)ethanesulfonamide.
| Compound Name | 1-diethoxyphosphoryl-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-N-(2-trimethylsilylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 153430020 |
| Molecular Formula | C25H39N4O8PSSi |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 1-diethoxyphosphoryl-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-N-(2-trimethylsilylethyl)ethanesulfonamide |
| SMILES | CCOP(=O)(OCC)C(C)S(=O)(=O)N(CC[Si](C)(C)C)c1nnc(-c2ccco2)n1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C25H39N4O8PSSi/c1-9-36-38(30,37-10-2)19(3)39(31,32)28(16-18-40(6,7)8)25-27-26-24(22-15-12-17-35-22)29(25)23-20(33-4)13-11-14-21(23)34-5/h11-15,17,19H,9-10,16,18H2,1-8H3 |
| InChIKey | LNUZZFXVTSQPCT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 135.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|