C20H31NO2S — CID 142360276
N-prop-2-enyl-N-[6-[3-(2-sulfanylethoxy)phenyl]heptyl]acetamide (PubChem CID 142360276) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is N-prop-2-enyl-N-[6-[3-(2-sulfanylethoxy)phenyl]heptyl]acetamide.
| Compound Name | N-prop-2-enyl-N-[6-[3-(2-sulfanylethoxy)phenyl]heptyl]acetamide |
|---|---|
| PubChem CID | 142360276 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | N-prop-2-enyl-N-[6-[3-(2-sulfanylethoxy)phenyl]heptyl]acetamide |
| SMILES | C=CCN(CCCCCC(C)c1cccc(OCCS)c1)C(C)=O |
| InChI | InChI=1S/C20H31NO2S/c1-4-12-21(18(3)22)13-7-5-6-9-17(2)19-10-8-11-20(16-19)23-14-15-24/h4,8,10-11,16-17,24H,1,5-7,9,12-15H2,2-3H3 |
| InChIKey | BHMSLTRIJGSHDZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|