C21H37NO2S — CID 142360497
2-(2-cyclopropylethoxy)ethanethiol;1-[3-(cyclopropylmethoxy)phenyl]ethanamine;ethane (PubChem CID 142360497) has the molecular formula C21H37NO2S and a molecular weight of 367.60 g/mol. Its IUPAC name is 2-(2-cyclopropylethoxy)ethanethiol;1-[3-(cyclopropylmethoxy)phenyl]ethanamine;ethane.
| Compound Name | 2-(2-cyclopropylethoxy)ethanethiol;1-[3-(cyclopropylmethoxy)phenyl]ethanamine;ethane |
|---|---|
| PubChem CID | 142360497 |
| Molecular Formula | C21H37NO2S |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-(2-cyclopropylethoxy)ethanethiol;1-[3-(cyclopropylmethoxy)phenyl]ethanamine;ethane |
| SMILES | CC.CC(N)c1cccc(OCC2CC2)c1.SCCOCCC1CC1 |
| InChI | InChI=1S/C12H17NO.C7H14OS.C2H6/c1-9(13)11-3-2-4-12(7-11)14-8-10-5-6-10;9-6-5-8-4-3-7-1-2-7;1-2/h2-4,7,9-10H,5-6,8,13H2,1H3;7,9H,1-6H2;1-2H3 |
| InChIKey | WAAOMTQWQJGUDA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|