C18H32O4S — CID 142360571
1-[3-(cyclopropylmethoxy)phenyl]ethanol;ethane;2-(2-sulfanylethoxy)ethanol (PubChem CID 142360571) has the molecular formula C18H32O4S and a molecular weight of 344.52 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)phenyl]ethanol;ethane;2-(2-sulfanylethoxy)ethanol.
| Compound Name | 1-[3-(cyclopropylmethoxy)phenyl]ethanol;ethane;2-(2-sulfanylethoxy)ethanol |
|---|---|
| PubChem CID | 142360571 |
| Molecular Formula | C18H32O4S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)phenyl]ethanol;ethane;2-(2-sulfanylethoxy)ethanol |
| SMILES | CC.CC(O)c1cccc(OCC2CC2)c1.OCCOCCS |
| InChI | InChI=1S/C12H16O2.C4H10O2S.C2H6/c1-9(13)11-3-2-4-12(7-11)14-8-10-5-6-10;5-1-2-6-3-4-7;1-2/h2-4,7,9-10,13H,5-6,8H2,1H3;5,7H,1-4H2;1-2H3 |
| InChIKey | ISZQVYAMRJXWJG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|