C17H32N2 — CID 142360935
propane;5-propyl-2-(2,3,3-trimethylbutan-2-yl)pyrimidine (PubChem CID 142360935) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is propane;5-propyl-2-(2,3,3-trimethylbutan-2-yl)pyrimidine.
| Compound Name | propane;5-propyl-2-(2,3,3-trimethylbutan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 142360935 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | propane;5-propyl-2-(2,3,3-trimethylbutan-2-yl)pyrimidine |
| SMILES | CCC.CCCc1cnc(C(C)(C)C(C)(C)C)nc1 |
| InChI | InChI=1S/C14H24N2.C3H8/c1-7-8-11-9-15-12(16-10-11)14(5,6)13(2,3)4;1-3-2/h9-10H,7-8H2,1-6H3;3H2,1-2H3 |
| InChIKey | YVYMQALKDNXTIL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |