C14H25N3 — CID 71106875
N-butyl-N,5-dipropylpyrimidin-2-amine (PubChem CID 71106875) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-butyl-N,5-dipropylpyrimidin-2-amine.
| Compound Name | N-butyl-N,5-dipropylpyrimidin-2-amine |
|---|---|
| PubChem CID | 71106875 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-butyl-N,5-dipropylpyrimidin-2-amine |
| SMILES | CCCCN(CCC)c1ncc(CCC)cn1 |
| InChI | InChI=1S/C14H25N3/c1-4-7-10-17(9-6-3)14-15-11-13(8-5-2)12-16-14/h11-12H,4-10H2,1-3H3 |
| InChIKey | JICZPZROUHFGOH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |