C20H37N3 — CID 18735804
N-(3,3-dimethylbutyl)-N-heptan-2-yl-5-propylpyrimidin-2-amine (PubChem CID 18735804) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N-heptan-2-yl-5-propylpyrimidin-2-amine.
| Compound Name | N-(3,3-dimethylbutyl)-N-heptan-2-yl-5-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 18735804 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N-heptan-2-yl-5-propylpyrimidin-2-amine |
| SMILES | CCCCCC(C)N(CCC(C)(C)C)c1ncc(CCC)cn1 |
| InChI | InChI=1S/C20H37N3/c1-7-9-10-12-17(3)23(14-13-20(4,5)6)19-21-15-18(11-8-2)16-22-19/h15-17H,7-14H2,1-6H3 |
| InChIKey | NLOWPFDJIHWWLZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|