About 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine
5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine (PubChem CID 18735580) has the molecular formula C23H43N3
and a molecular weight of 361.62 g/mol. Its IUPAC name is 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine |
| PubChem CID | 18735580 |
| Molecular Formula | C23H43N3 |
| Molecular Weight | 361.62 g/mol |
| Exact Mass | 361.35 |
| IUPAC Name | 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine |
| SMILES | CCCCc1cnc(N(CCC(C)(C)C)C(CCCC)CCCC)nc1 |
| InChI | InChI=1S/C23H43N3/c1-7-10-13-20-18-24-22(25-19-20)26(17-16-23(4,5)6)21(14-11-8-2)15-12-9-3/h18-19,21H,7-17H2,1-6H3 |
| InChIKey | KKCGBLHWGSMLRT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine?
The IUPAC name of 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine (CID 18735580) is 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine.
What is the SMILES notation for 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine?
The canonical SMILES for 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine is CCCCc1cnc(N(CCC(C)(C)C)C(CCCC)CCCC)nc1.
What is the InChIKey of 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine?
The InChIKey is KKCGBLHWGSMLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H43N3/c1-7-10-13-20-18-24-22(25-19-20)26(17-16-23(4,5)6)21(14-11-8-2)15-12-9-3/h18-19,21H,7-17H2,1-6H3.
What are the key properties of 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine?
5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine has a molecular weight of 361.62 g/mol, XLogP of 6.81, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-N-(3,3-dimethylbutyl)-N-nonan-5-ylpyrimidin-2-amine is sourced from PubChem (CID 18735580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).