C19H35N3 — CID 71106937
N,4-dibutyl-N-heptan-2-ylpyrimidin-2-amine (PubChem CID 71106937) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is N,4-dibutyl-N-heptan-2-ylpyrimidin-2-amine.
| Compound Name | N,4-dibutyl-N-heptan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 71106937 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | N,4-dibutyl-N-heptan-2-ylpyrimidin-2-amine |
| SMILES | CCCCCC(C)N(CCCC)c1nccc(CCCC)n1 |
| InChI | InChI=1S/C19H35N3/c1-5-8-11-12-17(4)22(16-10-7-3)19-20-15-14-18(21-19)13-9-6-2/h14-15,17H,5-13,16H2,1-4H3 |
| InChIKey | NTZGUTACWNJUMZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|