C15H28N2 — CID 142361365
5-(3,3-dimethylbutyl)-3-propan-2-ylpyridazine;ethane (PubChem CID 142361365) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 5-(3,3-dimethylbutyl)-3-propan-2-ylpyridazine;ethane.
| Compound Name | 5-(3,3-dimethylbutyl)-3-propan-2-ylpyridazine;ethane |
|---|---|
| PubChem CID | 142361365 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 5-(3,3-dimethylbutyl)-3-propan-2-ylpyridazine;ethane |
| SMILES | CC.CC(C)c1cc(CCC(C)(C)C)cnn1 |
| InChI | InChI=1S/C13H22N2.C2H6/c1-10(2)12-8-11(9-14-15-12)6-7-13(3,4)5;1-2/h8-10H,6-7H2,1-5H3;1-2H3 |
| InChIKey | FGGYOYGWVXDHJA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |