About 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane
1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane (PubChem CID 171834483) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane.
Analyze 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane?
The IUPAC name of 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane (CID 171834483) is 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane.
What is the SMILES notation for 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane?
The canonical SMILES for 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane is C.CC(C)c1ccc(CCC(C)(C)C)cc1.
What is the InChIKey of 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane?
The InChIKey is JLZBNDFQFZEBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.CH4/c1-12(2)14-8-6-13(7-9-14)10-11-15(3,4)5;/h6-9,12H,10-11H2,1-5H3;1H4.
What are the key properties of 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane?
1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane has a molecular weight of 220.40 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutyl)-4-propan-2-ylbenzene;methane is sourced from PubChem (CID 171834483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).