C13H14F2N4O3 — CID 142362010
2-[[6-(difluoromethoxy)-3-pyridinyl]amino]pyrimidine-4-carboxylic acid;ethane (PubChem CID 142362010) has the molecular formula C13H14F2N4O3 and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-[[6-(difluoromethoxy)-3-pyridinyl]amino]pyrimidine-4-carboxylic acid;ethane.
| Compound Name | 2-[[6-(difluoromethoxy)-3-pyridinyl]amino]pyrimidine-4-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142362010 |
| Molecular Formula | C13H14F2N4O3 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-[[6-(difluoromethoxy)-3-pyridinyl]amino]pyrimidine-4-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1ccnc(Nc2ccc(OC(F)F)nc2)n1 |
| InChI | InChI=1S/C11H8F2N4O3.C2H6/c12-10(13)20-8-2-1-6(5-15-8)16-11-14-4-3-7(17-11)9(18)19;1-2/h1-5,10H,(H,18,19)(H,14,16,17);1-2H3 |
| InChIKey | GWAYJZMYQDMQQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |