C21H30N2O3 — CID 142365609
3-[1-[2-(3-ethoxy-3-methylbut-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol (PubChem CID 142365609) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-[1-[2-(3-ethoxy-3-methylbut-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol.
| Compound Name | 3-[1-[2-(3-ethoxy-3-methylbut-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol |
|---|---|
| PubChem CID | 142365609 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-[1-[2-(3-ethoxy-3-methylbut-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol |
| SMILES | CCOC(C)(C)C#Cc1cc(N2CCC(OC3CC(O)C3)CC2)ccn1 |
| InChI | InChI=1S/C21H30N2O3/c1-4-25-21(2,3)9-5-16-13-17(6-10-22-16)23-11-7-19(8-12-23)26-20-14-18(24)15-20/h6,10,13,18-20,24H,4,7-8,11-12,14-15H2,1-3H3 |
| InChIKey | YSGUVCNAGMTVJD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|