C10H11N3O — CID 104892898
4-[(3S)-3-hydroxypyrrolidin-1-yl]pyridine-2-carbonitrile (PubChem CID 104892898) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-[(3S)-3-hydroxypyrrolidin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 4-[(3S)-3-hydroxypyrrolidin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 104892898 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-[(3S)-3-hydroxypyrrolidin-1-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(N2CC[C@H](O)C2)ccn1 |
| InChI | InChI=1S/C10H11N3O/c11-6-8-5-9(1-3-12-8)13-4-2-10(14)7-13/h1,3,5,10,14H,2,4,7H2/t10-/m0/s1 |
| InChIKey | YOHSGPJGGNODCA-JTQLQIEISA-N |
| XLogP | 0.52 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |