C12H15N3O — CID 62491625
4-(2,6-dimethylmorpholin-4-yl)pyridine-2-carbonitrile (PubChem CID 62491625) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62491625 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)pyridine-2-carbonitrile |
| SMILES | CC1CN(c2ccnc(C#N)c2)CC(C)O1 |
| InChI | InChI=1S/C12H15N3O/c1-9-7-15(8-10(2)16-9)12-3-4-14-11(5-12)6-13/h3-5,9-10H,7-8H2,1-2H3 |
| InChIKey | XUHOKUSOGQBGPL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |