C11H12FN3 — CID 126772752
4-(3-fluoropiperidin-1-yl)pyridine-2-carbonitrile (PubChem CID 126772752) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 4-(3-fluoropiperidin-1-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(3-fluoropiperidin-1-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 126772752 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-(3-fluoropiperidin-1-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(N2CCCC(F)C2)ccn1 |
| InChI | InChI=1S/C11H12FN3/c12-9-2-1-5-15(8-9)11-3-4-14-10(6-11)7-13/h3-4,6,9H,1-2,5,8H2 |
| InChIKey | RRZHZWPGGJRGTP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |