C29H42BN3O5 — CID 142365740
4-(dimethylamino)-N-[7-oxo-7-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxyamino]heptyl]benzamide (PubChem CID 142365740) has the molecular formula C29H42BN3O5 and a molecular weight of 523.48 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[7-oxo-7-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxyamino]heptyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[7-oxo-7-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxyamino]heptyl]benzamide |
|---|---|
| PubChem CID | 142365740 |
| Molecular Formula | C29H42BN3O5 |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 4-(dimethylamino)-N-[7-oxo-7-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxyamino]heptyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)NCCCCCCC(=O)NOCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C29H42BN3O5/c1-28(2)29(3,4)38-30(37-28)24-16-12-22(13-17-24)21-36-32-26(34)11-9-7-8-10-20-31-27(35)23-14-18-25(19-15-23)33(5)6/h12-19H,7-11,20-21H2,1-6H3,(H,31,35)(H,32,34) |
| InChIKey | KKDAMVDDCRFSLC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|