About 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane
1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane (PubChem CID 142366405) has the molecular formula C19H40
and a molecular weight of 268.53 g/mol. Its IUPAC name is 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane.
Molecular Properties
| Compound Name | 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane |
| PubChem CID | 142366405 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane |
| SMILES | CC.CC(C)(C)C1(C)CCCCC1.CCC1CCC1 |
| InChI | InChI=1S/C11H22.C6H12.C2H6/c1-10(2,3)11(4)8-6-5-7-9-11;1-2-6-4-3-5-6;1-2/h5-9H2,1-4H3;6H,2-5H2,1H3;1-2H3 |
| InChIKey | KKQPLFYKZSPBDW-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane?
The IUPAC name of 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane (CID 142366405) is 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane.
What is the SMILES notation for 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane?
The canonical SMILES for 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane is CC.CC(C)(C)C1(C)CCCCC1.CCC1CCC1.
What is the InChIKey of 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane?
The InChIKey is KKQPLFYKZSPBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.C6H12.C2H6/c1-10(2,3)11(4)8-6-5-7-9-11;1-2-6-4-3-5-6;1-2/h5-9H2,1-4H3;6H,2-5H2,1H3;1-2H3.
What are the key properties of 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane?
1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane has a molecular weight of 268.53 g/mol, XLogP of 7.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-methylcyclohexane;ethane;ethylcyclobutane is sourced from PubChem (CID 142366405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).