C13H18N2O4S2 — CID 14236651
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pyridin-2-yldisulfanyl)propanoic acid (PubChem CID 14236651) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pyridin-2-yldisulfanyl)propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pyridin-2-yldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 14236651 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pyridin-2-yldisulfanyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CSSc1ccccn1)C(=O)O |
| InChI | InChI=1S/C13H18N2O4S2/c1-13(2,3)19-12(18)15-9(11(16)17)8-20-21-10-6-4-5-7-14-10/h4-7,9H,8H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | XTLMRQHNCDVULJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|