C19H17N3O6S — CID 1423669
(5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 1423669) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is (5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1423669 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(/C=C2/SC(N3CCOCC3)=NC2=O)o1 |
| InChI | InChI=1S/C19H17N3O6S/c1-26-16-10-12(22(24)25)2-4-14(16)15-5-3-13(28-15)11-17-18(23)20-19(29-17)21-6-8-27-9-7-21/h2-5,10-11H,6-9H2,1H3/b17-11+ |
| InChIKey | ZPLXWLKSXXWCGF-GZTJUZNOSA-N |
| XLogP | 3.17 |
| TPSA | 107.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|