C21H31NO3 — CID 142368063
6-[5-(3-methoxycyclobutyl)oxy-6-methyl-2-pyridinyl]-2,2,4,4-tetramethylhex-5-yn-1-ol (PubChem CID 142368063) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 6-[5-(3-methoxycyclobutyl)oxy-6-methyl-2-pyridinyl]-2,2,4,4-tetramethylhex-5-yn-1-ol.
| Compound Name | 6-[5-(3-methoxycyclobutyl)oxy-6-methyl-2-pyridinyl]-2,2,4,4-tetramethylhex-5-yn-1-ol |
|---|---|
| PubChem CID | 142368063 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 6-[5-(3-methoxycyclobutyl)oxy-6-methyl-2-pyridinyl]-2,2,4,4-tetramethylhex-5-yn-1-ol |
| SMILES | COC1CC(Oc2ccc(C#CC(C)(C)CC(C)(C)CO)nc2C)C1 |
| InChI | InChI=1S/C21H31NO3/c1-15-19(25-18-11-17(12-18)24-6)8-7-16(22-15)9-10-20(2,3)13-21(4,5)14-23/h7-8,17-18,23H,11-14H2,1-6H3 |
| InChIKey | JWRVPCRBSJAOHM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|