C16H28N2O3 — CID 142369498
ethane;formic acid;(5-methyl-2-pyridinyl)-pyrrolidin-1-ylmethanone (PubChem CID 142369498) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethane;formic acid;(5-methyl-2-pyridinyl)-pyrrolidin-1-ylmethanone.
| Compound Name | ethane;formic acid;(5-methyl-2-pyridinyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 142369498 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | ethane;formic acid;(5-methyl-2-pyridinyl)-pyrrolidin-1-ylmethanone |
| SMILES | CC.CC.Cc1ccc(C(=O)N2CCCC2)nc1.O=CO |
| InChI | InChI=1S/C11H14N2O.2C2H6.CH2O2/c1-9-4-5-10(12-8-9)11(14)13-6-2-3-7-13;2*1-2;2-1-3/h4-5,8H,2-3,6-7H2,1H3;2*1-2H3;1H,(H,2,3) |
| InChIKey | WQMCFGDMDMIHEV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|