C16H28N2O3 — CID 142369524
ethane;methanol;1-(5-methylpyridine-2-carbonyl)azetidine-3-carbaldehyde (PubChem CID 142369524) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethane;methanol;1-(5-methylpyridine-2-carbonyl)azetidine-3-carbaldehyde.
| Compound Name | ethane;methanol;1-(5-methylpyridine-2-carbonyl)azetidine-3-carbaldehyde |
|---|---|
| PubChem CID | 142369524 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | ethane;methanol;1-(5-methylpyridine-2-carbonyl)azetidine-3-carbaldehyde |
| SMILES | CC.CC.CO.Cc1ccc(C(=O)N2CC(C=O)C2)nc1 |
| InChI | InChI=1S/C11H12N2O2.2C2H6.CH4O/c1-8-2-3-10(12-4-8)11(15)13-5-9(6-13)7-14;3*1-2/h2-4,7,9H,5-6H2,1H3;2*1-2H3;2H,1H3 |
| InChIKey | NPRFHWZGPORPFK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|