C43H30N4 — CID 142370322
6-[3-ethenyl-1-phenyl-2-[(Z)-prop-1-enyl]indol-5-yl]-2-phenyl-2,10,20-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),3(8),4,6,9,11,13(21),14,16,18-decaene (PubChem CID 142370322) has the molecular formula C43H30N4 and a molecular weight of 602.74 g/mol. Its IUPAC name is 6-[3-ethenyl-1-phenyl-2-[(Z)-prop-1-enyl]indol-5-yl]-2-phenyl-2,10,20-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),3(8),4,6,9,11,13(21),14,16,18-decaene.
| Compound Name | 6-[3-ethenyl-1-phenyl-2-[(Z)-prop-1-enyl]indol-5-yl]-2-phenyl-2,10,20-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),3(8),4,6,9,11,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 142370322 |
| Molecular Formula | C43H30N4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 6-[3-ethenyl-1-phenyl-2-[(Z)-prop-1-enyl]indol-5-yl]-2-phenyl-2,10,20-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),3(8),4,6,9,11,13(21),14,16,18-decaene |
| SMILES | C=Cc1c(/C=C\C)n(-c2ccccc2)c2ccc(-c3ccc4c(c3)-c3nccc5c3c(nc3ccccc35)N4c3ccccc3)cc12 |
| InChI | InChI=1S/C43H30N4/c1-3-13-38-32(4-2)35-26-28(20-22-39(35)46(38)30-14-7-5-8-15-30)29-21-23-40-36(27-29)42-41-34(24-25-44-42)33-18-11-12-19-37(33)45-43(41)47(40)31-16-9-6-10-17-31/h3-27H,2H2,1H3/b13-3- |
| InChIKey | PNHCUXMEIFGWRZ-DXNYSGJVSA-N |
| XLogP | 11.52 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|