C18H23FN2O3S2 — CID 142371292
(2S)-2-[[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]-4-methylpentanoic acid;methanethiol (PubChem CID 142371292) has the molecular formula C18H23FN2O3S2 and a molecular weight of 398.53 g/mol. Its IUPAC name is (2S)-2-[[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]-4-methylpentanoic acid;methanethiol.
| Compound Name | (2S)-2-[[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]-4-methylpentanoic acid;methanethiol |
|---|---|
| PubChem CID | 142371292 |
| Molecular Formula | C18H23FN2O3S2 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (2S)-2-[[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]-4-methylpentanoic acid;methanethiol |
| SMILES | CC(C)C[C@H](NC(=O)Cc1csc(-c2ccccc2F)n1)C(=O)O.CS |
| InChI | InChI=1S/C17H19FN2O3S.CH4S/c1-10(2)7-14(17(22)23)20-15(21)8-11-9-24-16(19-11)12-5-3-4-6-13(12)18;1-2/h3-6,9-10,14H,7-8H2,1-2H3,(H,20,21)(H,22,23);2H,1H3/t14-;/m0./s1 |
| InChIKey | SBJBCTQTMVPZMU-UQKRIMTDSA-N |
| XLogP | 3.65 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|