C23H37NO2 — CID 142371774
N-[3-[1-hexan-3-yl-2-methyl-4-oxo-3-[(1Z,3Z)-penta-1,3-dienyl]cyclopent-2-en-1-yl]butyl]-N-methylformamide (PubChem CID 142371774) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is N-[3-[1-hexan-3-yl-2-methyl-4-oxo-3-[(1Z,3Z)-penta-1,3-dienyl]cyclopent-2-en-1-yl]butyl]-N-methylformamide.
| Compound Name | N-[3-[1-hexan-3-yl-2-methyl-4-oxo-3-[(1Z,3Z)-penta-1,3-dienyl]cyclopent-2-en-1-yl]butyl]-N-methylformamide |
|---|---|
| PubChem CID | 142371774 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | N-[3-[1-hexan-3-yl-2-methyl-4-oxo-3-[(1Z,3Z)-penta-1,3-dienyl]cyclopent-2-en-1-yl]butyl]-N-methylformamide |
| SMILES | C/C=C\C=C/C1=C(C)C(C(C)CCN(C)C=O)(C(CC)CCC)CC1=O |
| InChI | InChI=1S/C23H37NO2/c1-7-10-11-13-21-19(5)23(16-22(21)26,20(9-3)12-8-2)18(4)14-15-24(6)17-25/h7,10-11,13,17-18,20H,8-9,12,14-16H2,1-6H3/b10-7-,13-11- |
| InChIKey | LIESRQVQWKQVNI-BXUXAFCHSA-N |
| XLogP | 5.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|