C27H43NO3 — CID 142235962
N,2-dimethyl-N-[(5R,10E)-5,9,13-trimethyl-4-(3-methyl-2-oxobut-3-enyl)-12-oxotetradeca-10,13-dienyl]prop-2-enamide (PubChem CID 142235962) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is N,2-dimethyl-N-[(5R,10E)-5,9,13-trimethyl-4-(3-methyl-2-oxobut-3-enyl)-12-oxotetradeca-10,13-dienyl]prop-2-enamide.
| Compound Name | N,2-dimethyl-N-[(5R,10E)-5,9,13-trimethyl-4-(3-methyl-2-oxobut-3-enyl)-12-oxotetradeca-10,13-dienyl]prop-2-enamide |
|---|---|
| PubChem CID | 142235962 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | N,2-dimethyl-N-[(5R,10E)-5,9,13-trimethyl-4-(3-methyl-2-oxobut-3-enyl)-12-oxotetradeca-10,13-dienyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)/C=C/C(C)CCC[C@@H](C)C(CCCN(C)C(=O)C(=C)C)CC(=O)C(=C)C |
| InChI | InChI=1S/C27H43NO3/c1-19(2)25(29)16-15-22(7)12-10-13-23(8)24(18-26(30)20(3)4)14-11-17-28(9)27(31)21(5)6/h15-16,22-24H,1,3,5,10-14,17-18H2,2,4,6-9H3/b16-15+/t22?,23-,24?/m1/s1 |
| InChIKey | SZVCLHZQXWIIBQ-WKVRYVSGSA-N |
| XLogP | 6.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|