C28H44N6O4 — CID 142371894
8-[4-(6-amino-3-pyridinyl)piperazin-1-yl]-N-[1-[(2R,4R)-4-hydroxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-ylidene]-8-oxooctanamide (PubChem CID 142371894) has the molecular formula C28H44N6O4 and a molecular weight of 528.70 g/mol. Its IUPAC name is 8-[4-(6-amino-3-pyridinyl)piperazin-1-yl]-N-[1-[(2R,4R)-4-hydroxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-ylidene]-8-oxooctanamide.
| Compound Name | 8-[4-(6-amino-3-pyridinyl)piperazin-1-yl]-N-[1-[(2R,4R)-4-hydroxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-ylidene]-8-oxooctanamide |
|---|---|
| PubChem CID | 142371894 |
| Molecular Formula | C28H44N6O4 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | 8-[4-(6-amino-3-pyridinyl)piperazin-1-yl]-N-[1-[(2R,4R)-4-hydroxy-2-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-ylidene]-8-oxooctanamide |
| SMILES | C[C@@H]1C[C@@H](O)CN1C(=O)/C(=N/C(=O)CCCCCCC(=O)N1CCN(c2ccc(N)nc2)CC1)C(C)(C)C |
| InChI | InChI=1S/C28H44N6O4/c1-20-17-22(35)19-34(20)27(38)26(28(2,3)4)31-24(36)9-7-5-6-8-10-25(37)33-15-13-32(14-16-33)21-11-12-23(29)30-18-21/h11-12,18,20,22,35H,5-10,13-17,19H2,1-4H3,(H2,29,30)/b31-26-/t20-,22-/m1/s1 |
| InChIKey | CJGQUQMZJIJRBU-BAUVRSOESA-N |
| XLogP | 2.65 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|