C19H17F2N5O — CID 142372129
3-fluoropyridine;N-[1-(5-fluoro-3-pyridinyl)pyrazol-3-yl]spiro[2.2]pentane-2-carboxamide (PubChem CID 142372129) has the molecular formula C19H17F2N5O and a molecular weight of 369.38 g/mol. Its IUPAC name is 3-fluoropyridine;N-[1-(5-fluoro-3-pyridinyl)pyrazol-3-yl]spiro[2.2]pentane-2-carboxamide.
| Compound Name | 3-fluoropyridine;N-[1-(5-fluoro-3-pyridinyl)pyrazol-3-yl]spiro[2.2]pentane-2-carboxamide |
|---|---|
| PubChem CID | 142372129 |
| Molecular Formula | C19H17F2N5O |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-fluoropyridine;N-[1-(5-fluoro-3-pyridinyl)pyrazol-3-yl]spiro[2.2]pentane-2-carboxamide |
| SMILES | Fc1cccnc1.O=C(Nc1ccn(-c2cncc(F)c2)n1)C1CC12CC2 |
| InChI | InChI=1S/C14H13FN4O.C5H4FN/c15-9-5-10(8-16-7-9)19-4-1-12(18-19)17-13(20)11-6-14(11)2-3-14;6-5-2-1-3-7-4-5/h1,4-5,7-8,11H,2-3,6H2,(H,17,18,20);1-4H |
| InChIKey | FKGLIYRANFEZJU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |