About 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile
1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile (PubChem CID 142372438) has the molecular formula C17H21F3N2O
and a molecular weight of 326.36 g/mol. Its IUPAC name is 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile.
Molecular Properties
| Compound Name | 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile |
| PubChem CID | 142372438 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile |
| SMILES | CC(F)F.CCC(c1cc(F)cc(C#N)c1)N1CCC(C)C1=O |
| InChI | InChI=1S/C15H17FN2O.C2H4F2/c1-3-14(18-5-4-10(2)15(18)19)12-6-11(9-17)7-13(16)8-12;1-2(3)4/h6-8,10,14H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | FIQABIJMXLMHRV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile?
The IUPAC name of 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile (CID 142372438) is 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile.
What is the SMILES notation for 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile?
The canonical SMILES for 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile is CC(F)F.CCC(c1cc(F)cc(C#N)c1)N1CCC(C)C1=O.
What is the InChIKey of 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile?
The InChIKey is FIQABIJMXLMHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O.C2H4F2/c1-3-14(18-5-4-10(2)15(18)19)12-6-11(9-17)7-13(16)8-12;1-2(3)4/h6-8,10,14H,3-5H2,1-2H3;2H,1H3.
What are the key properties of 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile?
1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile has a molecular weight of 326.36 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethane;3-fluoro-5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]benzonitrile is sourced from PubChem (CID 142372438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).