C33H42N6O3 — CID 142373499
methanol;7-[6-(8-methylimidazo[1,2-a]pyrazin-6-yl)indazol-1-yl]heptanal;4-(4-methylphenyl)morpholine (PubChem CID 142373499) has the molecular formula C33H42N6O3 and a molecular weight of 570.74 g/mol. Its IUPAC name is methanol;7-[6-(8-methylimidazo[1,2-a]pyrazin-6-yl)indazol-1-yl]heptanal;4-(4-methylphenyl)morpholine.
| Compound Name | methanol;7-[6-(8-methylimidazo[1,2-a]pyrazin-6-yl)indazol-1-yl]heptanal;4-(4-methylphenyl)morpholine |
|---|---|
| PubChem CID | 142373499 |
| Molecular Formula | C33H42N6O3 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | methanol;7-[6-(8-methylimidazo[1,2-a]pyrazin-6-yl)indazol-1-yl]heptanal;4-(4-methylphenyl)morpholine |
| SMILES | CO.Cc1ccc(N2CCOCC2)cc1.Cc1nc(-c2ccc3cnn(CCCCCCC=O)c3c2)cn2ccnc12 |
| InChI | InChI=1S/C21H23N5O.C11H15NO.CH4O/c1-16-21-22-9-11-25(21)15-19(24-16)17-7-8-18-14-23-26(20(18)13-17)10-5-3-2-4-6-12-27;1-10-2-4-11(5-3-10)12-6-8-13-9-7-12;1-2/h7-9,11-15H,2-6,10H2,1H3;2-5H,6-9H2,1H3;2H,1H3 |
| InChIKey | YMPVXVMLLARYPZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|