C18H30N2O2 — CID 142375304
ethane;4-methyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one (PubChem CID 142375304) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethane;4-methyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one.
| Compound Name | ethane;4-methyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one |
|---|---|
| PubChem CID | 142375304 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | ethane;4-methyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one |
| SMILES | CC.CC1CCC(=O)CCCn2nc(CC3CCOC3)cc21 |
| InChI | InChI=1S/C16H24N2O2.C2H6/c1-12-4-5-15(19)3-2-7-18-16(12)10-14(17-18)9-13-6-8-20-11-13;1-2/h10,12-13H,2-9,11H2,1H3;1-2H3 |
| InChIKey | XMRHCAJQUHDIDZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |