C21H38N2O2 — CID 142375325
4,8-dimethyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one;ethane (PubChem CID 142375325) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 4,8-dimethyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one;ethane.
| Compound Name | 4,8-dimethyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one;ethane |
|---|---|
| PubChem CID | 142375325 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 4,8-dimethyl-2-(oxolan-3-ylmethyl)-4,5,6,8,9,10-hexahydropyrazolo[1,5-a]azonin-7-one;ethane |
| SMILES | CC.CC.CC1CCn2nc(CC3CCOC3)cc2C(C)CCC1=O |
| InChI | InChI=1S/C17H26N2O2.2C2H6/c1-12-3-4-17(20)13(2)5-7-19-16(12)10-15(18-19)9-14-6-8-21-11-14;2*1-2/h10,12-14H,3-9,11H2,1-2H3;2*1-2H3 |
| InChIKey | KWJULKWXQCSIJI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |